For research use only. Not for therapeutic Use.
Bcn-OH(CAT: L000538) is a chemically significant compound often utilized in organic and materials chemistry. Its action method primarily involves its role as a versatile reactant for various synthetic transformations. In organic chemistry, it can be employed for the modification and functionalization of organic molecules, enabling the creation of new compounds with diverse functionalities.
CAS Number | 1263291-41-3 |
Molecular Formula | C10H14O |
Purity | ≥95% |
IUPAC Name | [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methanol |
InChI | InChI=1S/C10H14O/c11-7-10-8-5-3-1-2-4-6-9(8)10/h8-11H,3-7H2/t8-,9+,10? |
InChIKey | NSVXZMGWYBICRW-ULKQDVFKSA-N |