For research use only, not for therapeutic use.
Bcn-OH(CAT: L000538) is a chemically significant compound often utilized in organic and materials chemistry. Its action method primarily involves its role as a versatile reactant for various synthetic transformations. In organic chemistry, it can be employed for the modification and functionalization of organic molecules, enabling the creation of new compounds with diverse functionalities.
| Catalog Number | L000538 |
| CAS Number | 1263291-41-3 |
| Molecular Formula | C10H14O |
| Purity | ≥95% |
| IUPAC Name | [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methanol |
| InChI | InChI=1S/C10H14O/c11-7-10-8-5-3-1-2-4-6-9(8)10/h8-11H,3-7H2/t8-,9+,10? |
| InChIKey | NSVXZMGWYBICRW-ULKQDVFKSA-N |
