For research use only. Not for therapeutic Use.
BCPA(CAT: I040922) is a selective regulator of Pin1 (Peptidyl-prolyl isomerase NIMA-interacting 1), a protein involved in the regulation of cellular processes such as cell cycle progression and apoptosis. Unlike cytotoxic agents, BCPA specifically modulates Pin1 activity without inducing cell death. It attenuates the reduction of Pin1 protein levels, thereby inhibiting RANKL-induced osteoclastogenesis, which is a critical process in bone resorption. By regulating osteoclast activation, BCPA holds potential for treating osteoporosis and other bone-related disorders. This compound is highly relevant for Metabolic Disease Research, particularly in developing therapies for osteoporosis by targeting the Pin1-mediated pathways in osteoclasts.
| CAS Number | 547731-67-9 |
| Synonyms | (E)-3-(2-chlorophenyl)-N-[4-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]butyl]prop-2-enamide |
| Molecular Formula | C22H22Cl2N2O2 |
| Purity | ≥95% |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[4-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]butyl]prop-2-enamide |
| InChI | InChI=1S/C22H22Cl2N2O2/c23-19-9-3-1-7-17(19)11-13-21(27)25-15-5-6-16-26-22(28)14-12-18-8-2-4-10-20(18)24/h1-4,7-14H,5-6,15-16H2,(H,25,27)(H,26,28)/b13-11+,14-12+ |
| InChIKey | KHDKYKZKDQMAKP-PHEQNACWSA-N |
| SMILES | C1=CC=C(C(=C1)C=CC(=O)NCCCCNC(=O)C=CC2=CC=CC=C2Cl)Cl |
