For research use only. Not for therapeutic Use.
BDM91270 (CAT: I040890) is an effective inhibitor of the AcrAB-TolC efflux pump in Escherichia coli, with an EC90 value of 0.6 μM for the wild-type AcrB component. By inhibiting this efflux pump, BDM91270 reduces the ability of E. coli to expel antimicrobial agents, thereby enhancing the effectiveness of antibiotics and overcoming bacterial resistance. This compound can be used in research focused on understanding and combating E. coli drug resistance mechanisms, making it valuable for Infection Disease Research, particularly in the development of strategies to mitigate bacterial resistance in clinical settings.
| CAS Number | 2892824-11-0 |
| Synonyms | [3-(aminomethyl)phenyl] 5-chloro-6-piperazin-1-ylpyridine-3-carboxylate;dihydrochloride |
| Molecular Formula | C17H21Cl3N4O2 |
| Purity | ≥95% |
| IUPAC Name | [3-(aminomethyl)phenyl] 5-chloro-6-piperazin-1-ylpyridine-3-carboxylate;dihydrochloride |
| InChI | InChI=1S/C17H19ClN4O2.2ClH/c18-15-9-13(11-21-16(15)22-6-4-20-5-7-22)17(23)24-14-3-1-2-12(8-14)10-19;;/h1-3,8-9,11,20H,4-7,10,19H2;2*1H |
| InChIKey | GKQBSWGNHZXAHN-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C(C=C(C=N2)C(=O)OC3=CC=CC(=C3)CN)Cl.Cl.Cl |
