For research use only. Not for therapeutic Use.
BDTX-1535（Cat No.:I041298）is an investigational therapeutic agent developed by Bold Therapeutics, designed to target and inhibit specific proteins involved in cancer cell survival and immune evasion. It functions as a monoclonal antibody that binds to immune checkpoints, thereby enhancing the body’s immune response against tumors. By blocking these immune checkpoints, BDTX-1535 aims to overcome tumor resistance mechanisms and activate T-cells to attack cancer cells. Early preclinical studies have demonstrated its potential in treating various cancers, including solid tumors, positioning BDTX-1535 as a promising candidate for immune-oncology therapy.
| CAS Number | 2607829-38-7 |
| Synonyms | (E)-N-[4-(3-chloro-2-fluoroanilino)-7-[2-[(1R,5S)-3-methyl-3-azabicyclo[3.1.0]hexan-1-yl]ethynyl]quinazolin-6-yl]-4-morpholin-4-ylbut-2-enamide |
| Molecular Formula | C30H30ClFN6O2 |
| Purity | ≥95% |
| IUPAC Name | (E)-N-[4-(3-chloro-2-fluoroanilino)-7-[2-[(1R,5S)-3-methyl-3-azabicyclo[3.1.0]hexan-1-yl]ethynyl]quinazolin-6-yl]-4-morpholin-4-ylbut-2-enamide |
| InChI | InChI=1S/C30H30ClFN6O2/c1-37-17-21-16-30(21,18-37)8-7-20-14-26-22(29(34-19-33-26)36-24-5-2-4-23(31)28(24)32)15-25(20)35-27(39)6-3-9-38-10-12-40-13-11-38/h2-6,14-15,19,21H,9-13,16-18H2,1H3,(H,35,39)(H,33,34,36)/b6-3+/t21-,30+/m1/s1 |
| InChIKey | LMOVDLRMIRLIJF-TUVXKDNKSA-N |
| SMILES | CN1C[C@H]2C[C@]2(C1)C#CC3=CC4=C(C=C3NC(=O)/C=C/CN5CCOCC5)C(=NC=N4)NC6=C(C(=CC=C6)Cl)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
