For research use only. Not for therapeutic Use.
Belvarafenib (Cat.No:I019679) is a small molecule inhibitor of BRAF kinase, a protein that plays a role in cell growth and division. It has shown potential as a targeted therapy for various types of cancers with BRAF mutations, such as melanoma and colorectal cancer. Belvarafenib is currently in clinical trials.
| Catalog Number | I019679 |
| CAS Number | 1446113-23-0 |
| Molecular Formula | C₂₃H₁₆ClFN₆OS |
| Purity | ≥95% |
| Target | Raf |
| IUPAC Name | 4-amino-N-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide |
| InChI | InChI=1S/C23H16ClFN6OS/c1-11-5-6-13-12(7-8-27-22(13)30-16-4-2-3-15(24)17(16)25)18(11)31-23(32)14-9-33-20-19(14)28-10-29-21(20)26/h2-10H,1H3,(H,27,30)(H,31,32)(H2,26,28,29) |
| InChIKey | KVCQTKNUUQOELD-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=NC=C2)NC3=C(C(=CC=C3)Cl)F)NC(=O)C4=CSC5=C4N=CN=C5N |
| Reference | [1]. WO 2013/100632 A1. |
