For research use only. Not for therapeutic Use.
Bendamustine(Cat No.:M074622)is a bifunctional alkylating agent used in cancer therapy, particularly for treating chronic lymphocytic leukemia (CLL), non-Hodgkin’s lymphoma (NHL), and multiple myeloma. It works by cross-linking DNA strands, disrupting DNA replication and transcription, ultimately leading to cell death. Bendamustine’s unique mechanism combines alkylating and purine analog properties, giving it efficacy in cases where other chemotherapeutics may fail. Its ability to induce apoptosis in both dividing and resting cancer cells makes it a valuable option for patients with hematological malignancies, offering a distinct therapeutic profile in oncology.
CAS Number | 16506-27-7 |
Molecular Formula | C16H21Cl2N3O2 |
Purity | ≥95% |
Target | Apoptosis |
Storage | -20°C |
IUPAC Name | 4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanoic acid |
InChI | InChI=1S/C16H21Cl2N3O2/c1-20-14-6-5-12(21(9-7-17)10-8-18)11-13(14)19-15(20)3-2-4-16(22)23/h5-6,11H,2-4,7-10H2,1H3,(H,22,23) |
InChIKey | YTKUWDBFDASYHO-UHFFFAOYSA-N |
SMILES | CN1C2=C(C=C(C=C2)N(CCCl)CCCl)N=C1CCCC(=O)O |