For research use only. Not for therapeutic Use.
Bengamide B(Cat No.:M004567) is a naturally occurring marine compound isolated from a sea sponge belonging to the genus Jaspis. It is part of the benzamide family of compounds, known for their potent antitumor activities. Bengamide B functions primarily by inhibiting methionine aminopeptidase 2, an enzyme involved in the removal of N-terminal methionine from nascent proteins, which is crucial for tumor growth and angiogenesis. This specific mechanism of action makes benzamide B a candidate for anticancer drug development, particularly in targeting cancer cells with minimal effects on normal tissues.
Catalog Number | M004567 |
CAS Number | 104947-69-5 |
Molecular Formula | C32H58N2O8 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | [(3S,6S)-1-methyl-7-oxo-6-[[(E,2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8-methylnon-6-enoyl]amino]azepan-3-yl] tetradecanoate |
InChI | InChI=1S/C32H58N2O8/c1-6-7-8-9-10-11-12-13-14-15-16-17-27(36)42-24-19-20-25(32(40)34(4)22-24)33-31(39)30(41-5)29(38)28(37)26(35)21-18-23(2)3/h18,21,23-26,28-30,35,37-38H,6-17,19-20,22H2,1-5H3,(H,33,39)/b21-18+/t24-,25-,26+,28-,29+,30+/m0/s1 |
InChIKey | PFRKTXMXGDERHT-UCDUEDMDSA-N |
SMILES | CCCCCCCCCCCCCC(=O)OC1CCC(C(=O)N(C1)C)NC(=O)C(C(C(C(C=CC(C)C)O)O)O)OC |