For research use only. Not for therapeutic Use.
Benz[a]anthracen-3-ol is a polycyclic aromatic compound featuring a hydroxyl group at the 3-position of the benz[a]anthracene framework. This compound is of interest in environmental and medicinal chemistry due to its potential biological activities and implications in toxicology. It is studied for its role in the metabolism of polycyclic aromatic hydrocarbons (PAHs) and their effects on human health, particularly in relation to carcinogenicity. Additionally, Benz[a]anthracen-3-ol serves as a valuable intermediate in the synthesis of various organic compounds.
CAS Number | 4834-35-9 |
Synonyms | 3-Hydroxybenz[a]anthracene |
Molecular Formula | C18H12O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | benzo[a]anthracen-3-ol |
InChI | InChI=1S/C18H12O/c19-16-7-8-17-15(10-16)6-5-14-9-12-3-1-2-4-13(12)11-18(14)17/h1-11,19H |
InChIKey | MRRWKFVZIOCJBS-UHFFFAOYSA-N |
SMILES | C1=CC=C2C=C3C(=CC2=C1)C=CC4=C3C=CC(=C4)O |