For research use only. Not for therapeutic Use.
Benz[a]anthracene-d12(Cat No.:R024573), is a deuterium-labeled derivative of benz[a]anthracene, a polycyclic aromatic hydrocarbon (PAH). It is used as an isotopic internal standard in analytical chemistry and environmental monitoring. The deuterium-labeled compound serves as a reference in studies involving benz[a]anthracene and related PAHs, enabling precise quantification and identification using techniques like mass spectrometry.
CAS Number | 1718-53-2 |
Synonyms | 1,2-Benz[a]anthracene-d4; 1,2-Benzanthracene-d4; 1,2-Benzanthrene-d4; 1,2-Benzoanthracene-d4; 2,3-Benzophenanthrene-d4; Benzanthracene-d4; Benzanthrene-d4; Benzo[a]anthracene-d4; Benzo[b]phenanthrene-d4; Benzoanthracene-d4; NSC 30970-d4; Tetraphene-d |
Molecular Formula | C18H12 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 1,2,3,4,5,6,7,8,9,10,11,12-dodecadeuteriobenzo[a]anthracene |
InChI | InChI=1S/C18H12/c1-2-7-15-12-18-16(11-14(15)6-1)10-9-13-5-3-4-8-17(13)18/h1-12H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D |
InChIKey | DXBHBZVCASKNBY-AQZSQYOVSA-N |
SMILES | C1=CC=C2C(=C1)C=CC3=CC4=CC=CC=C4C=C32 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |