For research use only. Not for therapeutic Use.
Benzamidine is a reversible inhibitor of serine proteases, including trypsin, plasmin, and thrombin (K<sub>i</sub>s = 35, 350, and 220 µM, respectively). In addition to its use as a general serine protease inhibitor, benzamidine is used, when immobilized, to purify novel proteases.
| Catalog Number | M123292 |
| CAS Number | 1670-14-0 |
| Synonyms | benzenecarboximidamide, monohydrochloride |
| Molecular Formula | C7H9ClN2 |
| Purity | ≥95% |
| Target | Ser/Thr Protease |
| Storage | Room temperature |
| IUPAC Name | benzenecarboximidamide;hydrochloride |
| InChI | InChI=1S/C7H8N2.ClH/c8-7(9)6-4-2-1-3-5-6;/h1-5H,(H3,8,9);1H |
| InChIKey | LZCZIHQBSCVGRD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=N)N.Cl |
