For research use only. Not for therapeutic Use.
Benzenamine, 3-(1,3,2-dioxaborinan-2-yl)- (CAT: L000165) is a significant compound with applications in organic chemistry and material science. Its action mechanism involves serving as a valuable boronic acid derivative for various chemical reactions. In organic chemistry, it acts as a versatile building block for the synthesis of pharmaceutical intermediates and agrochemicals. This compound plays a pivotal role in the development of novel molecules with therapeutic potential, particularly in the pharmaceutical industry.
CAS Number | 210775-52-3 |
Molecular Formula | C9H12BNO2 |
Purity | ≥95% |
IUPAC Name | 3-(1,3,2-dioxaborinan-2-yl)aniline |
InChI | InChI=1S/C9H12BNO2/c11-9-4-1-3-8(7-9)10-12-5-2-6-13-10/h1,3-4,7H,2,5-6,11H2 |
InChIKey | GBHALPQORITFRG-UHFFFAOYSA-N |