For research use only. Not for therapeutic Use.
Benzene, 1-isocyano-4-nitro- (9CI)(Cat No.:M121679) is a chemical compound with the molecular formula C7H4N2O2. It is characterized by a benzene ring substituted with an isocyanide (-NC) group at the first position and a nitro (-NO2) group at the fourth position. This compound is primarily used as a synthetic intermediate in organic chemistry for the preparation of various compounds. Its unique structure and reactivity make it valuable in the synthesis of pharmaceuticals, agrochemicals, and materials.
CAS Number | 1984-23-2 |
Molecular Formula | C7H4N2O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-isocyano-4-nitrobenzene |
InChI | InChI=1S/C7H4N2O2/c1-8-6-2-4-7(5-3-6)9(10)11/h2-5H |
InChIKey | WQFPYEBGLBCQOY-UHFFFAOYSA-N |
SMILES | [C-]#[N+]C1=CC=C(C=C1)[N+](=O)[O-] |