For research use only. Not for therapeutic Use.
Benzene (1,3,5-D3) is a deuterated form of benzene where the three hydrogen atoms at the 1, 3, and 5 positions are replaced with deuterium. This isotopic labeling enhances the precision of studying benzene’s behavior in chemical and biological systems. The deuterated benzene is used in research to investigate reaction mechanisms, metabolic pathways, and structural properties. Its application includes tracing chemical processes, analyzing reaction kinetics, and studying the interactions of benzene in various contexts. The detailed data obtained from such studies is valuable for optimizing chemical reactions and understanding the compound’s behavior in different environments.
CAS Number | 1684-47-5 |
Synonyms | BENZENE (1,3,5-D3) |
Molecular Formula | C6H6 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,3,5-trideuteriobenzene |
InChI | InChI=1S/C6H6/c1-2-4-6-5-3-1/h1-6H/i1D,4D,5D |
InChIKey | UHOVQNZJYSORNB-NHPOFCFZSA-N |
SMILES | [2H]C1=CC(=CC(=C1)[2H])[2H] |