For research use only. Not for therapeutic Use.
Benzene oxide(Cat No.:M048088), also known as oxepin or cyclohexa-2,5-diene-1-one, is an organic compound with the molecular formula C₆H₆O. It is an oxirane derivative where an oxygen atom is incorporated into a benzene ring, resulting in a three-membered epoxy ring. This unstable intermediate is crucial in the metabolism of benzene in the body, leading to various phenolic compounds. Benzene oxide is typically generated through oxidation processes and is a key intermediate in the synthesis of several pharmaceuticals and chemicals. Due to its reactivity, it plays a significant role in organic synthesis and metabolic studies.
CAS Number | 1488-25-1 |
Molecular Formula | C6H6O |
Purity | ≥95% |
Storage | Desiccate at +4C |
IUPAC Name | 7-oxabicyclo[4.1.0]hepta-2,4-diene |
InChI | InChI=1S/C6H6O/c1-2-4-6-5(3-1)7-6/h1-6H |
InChIKey | WDFZWSZNOFELJY-UHFFFAOYSA-N |
SMILES | C1=CC2C(O2)C=C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |