For research use only. Not for therapeutic Use.
Benzenesulfonic acid, 2,4,6-trimethyl-, sodium salt(Cat No.:L006943). It is the sodium salt of 2,4,6-trimethylbenzenesulfonic acid, a derivative of benzenesulfonic acid where three methyl groups are attached to the aromatic ring. This compound is widely used as a strong acidic catalyst in various organic reactions, including esterifications and alkylation processes. Its high acidity and stability under reaction conditions make it valuable in the synthesis of pharmaceuticals, fragrances, and specialty chemicals. The sodium salt form enhances its solubility and ease of handling, facilitating its use in chemical research and industrial applications.
CAS Number | 6148-75-0 |
Molecular Formula | C9H11NaO3S |
Purity | ≥95% |
IUPAC Name | sodium;2,4,6-trimethylbenzenesulfonate |
InChI | InChI=1S/C9H12O3S.Na/c1-6-4-7(2)9(8(3)5-6)13(10,11)12;/h4-5H,1-3H3,(H,10,11,12);/q;+1/p-1 |
InChIKey | AOJUNZYQOYSGHT-UHFFFAOYSA-M |
SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)[O-])C.[Na+] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |