For research use only. Not for therapeutic Use.
Benzethonium-d7 chloride(Cat No.:S000429) is a deuterated version of benzethonium chloride, where seven hydrogen atoms are replaced with deuterium. This modification enhances its stability for use in analytical and pharmacokinetic studies. Benzethonium chloride is a synthetic quaternary ammonium salt known for its antimicrobial properties, commonly used as a preservative and antiseptic in various consumer products and pharmaceuticals. It functions by disrupting microbial cell membranes, leading to cell death. The deuterated version, Benzethonium-d7 chloride, allows researchers to investigate the compound’s behavior in different environments, improving understanding of its efficacy and safety profiles.
Molecular Formula | C27H35D7ClNO2 |
Purity | ≥95% |
IUPAC Name | [dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl]-dimethyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium;chloride |
InChI | InChI=1S/C27H42NO2.ClH/c1-26(2,3)22-27(4,5)24-13-15-25(16-14-24)30-20-19-29-18-17-28(6,7)21-23-11-9-8-10-12-23;/h8-16H,17-22H2,1-7H3;1H/q+1;/p-1/i8D,9D,10D,11D,12D,21D2; |
InChIKey | UREZNYTWGJKWBI-HPUDLTRFSA-M |
SMILES | CC(C)(C)CC(C)(C)C1=CC=C(C=C1)OCCOCC[N+](C)(C)CC2=CC=CC=C2.[Cl-] |