For research use only. Not for therapeutic Use.
Benzimidazole (CAT: R028790) is a versatile heterocyclic compound that serves as a foundational building block in organic synthesis and pharmaceutical chemistry. With a bicyclic structure containing both benzene and imidazole rings, benzimidazole exhibits diverse pharmacological activities. It is commonly used as a core structure in the development of various drugs, including anthelmintics (used to treat parasitic worm infections), antifungal agents, and proton pump inhibitors that reduce stomach acid production. Benzimidazole derivatives also display potential anticancer properties by targeting specific cellular processes. Its wide range of applications underscores its significance in drug discovery and the creation of bioactive compounds for therapeutic purposes.
| CAS Number | 51-17-2 |
| Synonyms | 1H-Benzimidazole; 1,3-Benzodiazole; 1,3-Diazaindene; 3-Azaindole; Azindole; BZI; Benziminazole; Benzoglyoxaline; N,N’-Methenyl-o-phenylenediamine; NSC 759; o-Benzimidazole |
| Molecular Formula | C7H6N2 |
| Purity | ≥95% |
| Storage | Store at +4℃ |
| IUPAC Name | 1H-benzimidazole |
| InChI | InChI=1S/C7H6N2/c1-2-4-7-6(3-1)8-5-9-7/h1-5H,(H,8,9) |
| InChIKey | HYZJCKYKOHLVJF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC=N2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
