Home
>
Materials Science>Organic monomer of COF> Benzo[1,2-b:3,4-b':5,6-b'']trithiophene-2,5,8-tricarbaldehyde
For research use only. Not for therapeutic Use.
Benzo[1,2-b:3,4-b’:5,6-b”]trithiophene-2,5,8-tricarbaldehyde (Cat.No:L003840) is a pivotal compound in materials science. Its unique trithiophene structure and aldehyde groups impart specialized reactivity. This compound is integral in the synthesis of advanced materials, particularly in the development of organic semiconductors and optoelectronic devices.
CAS Number | 2243590-42-1 |
Molecular Formula | C15H6O3S3 |
Purity | ≥95% |
IUPAC Name | 3,8,13-trithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2(6),4,7(11),9,14-hexaene-4,9,14-tricarbaldehyde |
InChI | InChI=1S/C15H6O3S3/c16-4-7-1-10-13(19-7)11-3-9(6-18)21-15(11)12-2-8(5-17)20-14(10)12/h1-6H |
InChIKey | VANOLPNZHSSDOC-UHFFFAOYSA-N |
SMILES | C1=C(SC2=C1C3=C(C=C(S3)C=O)C4=C2C=C(S4)C=O)C=O |