For research use only. Not for therapeutic Use.
Benzo[1,2-b:4,5-b’]difuran-2,6(3H,7H)-dione (Cat.No:L004104) is a significant chemical compound with diverse applications. Its unique fused difuran ring system confers specialized reactivity and properties. This compound is employed as a key intermediate in the synthesis of specialized organic molecules with potential applications in pharmaceutical and materials research.
CAS Number | 30272-74-3 |
Molecular Formula | C10H6O4 |
Purity | ≥95% |
IUPAC Name | 3,7-dihydrofuro[2,3-f][1]benzofuran-2,6-dione |
InChI | InChI=1S/C10H6O4/c11-9-3-5-1-7-6(2-8(5)14-9)4-10(12)13-7/h1-2H,3-4H2 |
InChIKey | CQYVZXUUXPGQEI-UHFFFAOYSA-N |
SMILES | C1C2=CC3=C(CC(=O)O3)C=C2OC1=O |