For research use only. Not for therapeutic Use.
Benzo[a]pyrene diol epoxide is a highly reactive metabolite of benzo[a]pyrene, a polycyclic aromatic hydrocarbon known for its potent carcinogenic properties. This compound forms during the metabolic activation of benzo[a]pyrene, which occurs predominantly in the liver through enzymatic conversion. Benzo[a]pyrene diol epoxide interacts with DNA, forming adducts that can lead to mutations and ultimately cancer, making it a critical focus of study in toxicology and cancer research. Its understanding helps in assessing environmental and smoking-related cancer risks.
CAS Number | 58917-67-2 |
Synonyms | (7R,8S,8aS,9aR)-rel-7,8,8a,9a-Tetrahydrobenzo[10,11]chryseno[3,4-b]oxirene-7,8-diol; (7α,8β,8aα,9aα)-7,8,8a,9a-Tetrahydrobenzo[10,11]chryseno[3,4-b]oxirene-7,8-diol; (±)-7α,8β-Dihydroxy-9β,10β-epoxy-7,8,9,10-tetrahydrobenzo[a]pyrene; (±)-7β,8α-Dihyd |
Molecular Formula | C20H14O3 |
Purity | ≥95% |
Storage | -20 °C |
InChI | InChI=1S/C20H14O3/c21-17-13-8-11-5-4-9-2-1-3-10-6-7-12(15(11)14(9)10)16(13)19-20(23-19)18(17)22/h1-8,17-22H/t17-,18+,19-,20+/m1/s1 |
InChIKey | DQEPMTIXHXSFOR-WCIQWLHISA-N |
SMILES | C1=CC2=C3C(=C1)C=CC4=C3C(=CC5=C4C6C(O6)C(C5O)O)C=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |