For research use only. Not for therapeutic Use.
Benzo[b]thien-2-yl Ketone-D10 (Cat No.:R045724) is a high-purity, deuterated compound essential for advanced pharmaceutical and analytical research. This isotopically labeled version, featuring ten deuterium atoms, is crucial for studies on drug impurities, metabolism, and NMR spectroscopy. The stable isotope labeling ensures precise and reliable analytical results, enhancing the accuracy of experimental data. Ideal for various research applications, Benzo[b]thien-2-yl Ketone-D10 integrates seamlessly into existing protocols, providing a robust and cost-effective solution for high-precision scientific investigations and the development of innovative therapeutic agents, particularly in the context of Zileuton research.
CAS Number | NA |
Synonyms | Bis(benzo[b]thien-2-yl)methanone-D10 |
Molecular Formula | C₁₇D₁₀OS₂ |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | bis(3,4,5,6,7-pentadeuterio-1-benzothiophen-2-yl)methanone |
InChI | InChI=1S/C17H10OS2/c18-17(15-9-11-5-1-3-7-13(11)19-15)16-10-12-6-2-4-8-14(12)20-16/h1-10H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D |
InChIKey | XGEOFOPAAWHTSM-LHNTUAQVSA-N |
SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(S2)C(=O)C3=C(C4=C(C(=C(C(=C4S3)[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H] |