For research use only. Not for therapeutic Use.
Benzo[b]thiophene is a heterocyclic compound used in chemical synthesis and pharmaceutical research. It serves as a building block for creating a variety of biologically active molecules, including drugs and agrochemicals. This compound is essential for studying reaction mechanisms, developing new therapeutic agents, and exploring synthetic methodologies, ensuring precise and reliable results in advanced scientific research.
CAS Number | 95-15-8 |
Synonyms | 1-Benzothiophene; 1-Benzothiophene; 1-Thiaindene; 2,3-Benzothiophene; Benzothiofuran; Benzothiophen; Benzothiophene; NSC 47196; Thianaphthen; Thianaphthene; Thionaphthene; |
Molecular Formula | C8H6S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-benzothiophene |
InChI | InChI=1S/C8H6S/c1-2-4-8-7(3-1)5-6-9-8/h1-6H |
InChIKey | FCEHBMOGCRZNNI-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C=CS2 |