For research use only. Not for therapeutic Use.
Benzo[c][1,2,5]thiadiazole-4,7-diyldiboronic acid (Cat.No:L003884) is a pivotal compound in materials science. Its unique structure, containing boronic acid and thiadiazole moieties, imparts valuable reactivity. This compound serves as a crucial building block in the synthesis of specialized materials with applications in optoelectronic devices and organic semiconductors.
Catalog Number | L003884 |
CAS Number | 1332458-85-1 |
Molecular Formula | C6H6B2N2O4S |
Purity | ≥95% |
IUPAC Name | (4-borono-2,1,3-benzothiadiazol-7-yl)boronic acid |
InChI | InChI=1S/C6H6B2N2O4S/c11-7(12)3-1-2-4(8(13)14)6-5(3)9-15-10-6/h1-2,11-14H |
InChIKey | NZUIHJKGYPCTHI-UHFFFAOYSA-N |
SMILES | B(C1=CC=C(C2=NSN=C12)B(O)O)(O)O |