For research use only. Not for therapeutic Use.
Benzo[d][1,3]dioxole-5-carbonyl fluoride(CAT: L000299) is a compound with applications in material and organic chemistry. This chemical serves as a versatile reagent for the introduction of specific functional groups in organic synthesis. Its action method involves reacting with other compounds to introduce carbonyl fluoride functionality, making it valuable for various organic transformations. In material chemistry, it can be used for the preparation of specialized materials, often applied in the development of advanced materials with tailored properties.
CAS Number | 2254447-02-2 |
Molecular Formula | C8H5FO3 |
Purity | ≥95% |
IUPAC Name | 1,3-benzodioxole-5-carbonyl fluoride |
InChI | InChI=1S/C8H5FO3/c9-8(10)5-1-2-6-7(3-5)12-4-11-6/h1-3H,4H2 |
InChIKey | QKEALPNOCCMPEP-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |