For research use only. Not for therapeutic Use.
Benzoic acid-13C6 is an isotopically labeled compound in which all six carbon atoms in the benzene ring are replaced by the carbon-13 isotope. This labeled benzoic acid is widely used in pharmaceutical, environmental, and metabolic research as a tracer for studying metabolic pathways, compound stability, and degradation processes. Its stable isotope labeling allows precise tracking in analytical techniques like mass spectrometry and NMR, making it invaluable in pharmacokinetics, environmental monitoring, and biochemical studies focused on carbon distribution and metabolic flux analysis.
Catalog Number | S001130 |
CAS Number | 125945-98-4 |
Molecular Formula | C13C6H6O2 |
Purity | ≥95% |
IUPAC Name | (1,2,3,4,5,6-13C6)cyclohexatrienecarboxylic acid |
InChI | 1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9)/i1+1,2+1,3+1,4+1,5+1,6+1 |
InChIKey | WPYMKLBDIGXBTP-IDEBNGHGSA-N |
SMILES | [13CH]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)C(=O)O |