For research use only. Not for therapeutic Use.
Benzoic Acid-18O2 is a labeled form of benzoic acid, where both oxygen atoms in the carboxyl group are replaced with the oxygen-18 isotope. This isotopic labeling is particularly useful in research for studying reaction mechanisms, metabolic pathways, and tracing studies involving benzoic acid and its derivatives. The 18O labeling allows for precise tracking in various analytical techniques, such as mass spectrometry and NMR spectroscopy, providing valuable insights into the behavior and transformations of benzoic acid in chemical and biological systems.
CAS Number | 17217-84-4 |
Synonyms | Benzenecarboxylic Acid-18O2; Benzeneformic Acid-18O2; Benzenemethanoic Acid-18O2; Carboxybenzene-18O2; Dracylic Acid-18O2; E 210-18O2; HA 1-18O2; MENNO-Florades-18O2; NSC 149-18O2; Phenylcarboxylic Acid-18O2; Phenylformic Acid-18O2; Purox B-18O2; |
Molecular Formula | C7H6O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | benzoic acid |
InChI | InChI=1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9)/i8+2,9+2 |
InChIKey | WPYMKLBDIGXBTP-UUQIGZEMSA-N |
SMILES | C1=CC=C(C=C1)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |