For research use only. Not for therapeutic Use.
Benzoic acid, 2-bromo-3-(trifluoromethyl)-(Cat No.:M137369)is a chemically modified benzoic acid featuring a bromine atom and a trifluoromethyl group on its aromatic ring. This configuration imparts significant reactivity and unique electronic properties to the molecule, making it a valuable intermediate in organic synthesis, particularly in the pharmaceutical and agrochemical industries. The bromine atom facilitates various chemical transformations, including Suzuki coupling reactions, while the trifluoromethyl group enhances the compound’s lipophilicity and metabolic stability, crucial for developing more durable and effective therapeutic agents and specialty chemicals.
CAS Number | 177420-63-2 |
Molecular Formula | C8H4BrF3O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-bromo-3-(trifluoromethyl)benzoic acid |
InChI | InChI=1S/C8H4BrF3O2/c9-6-4(7(13)14)2-1-3-5(6)8(10,11)12/h1-3H,(H,13,14) |
InChIKey | FIMDBAHLQCCYJK-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1)C(F)(F)F)Br)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |