For research use only. Not for therapeutic Use.
Benzoic acid, 2-(hexahydro-1-methyl-1H-azepin-4-yl)hydrazide(Cat No.:M137045), is a chemical compound with potential pharmaceutical applications. It is a hydrazide derivative of benzoic acid, containing a six-membered ring with a methyl group and an azepine ring. This compound’s unique structure suggests possible use as a pharmacological agent, though further research is needed to fully understand its potential benefits and mechanisms of action. Its synthesis and characterization could contribute to the development of novel drugs or research tools in the pharmaceutical industry.
Catalog Number | M137045 |
CAS Number | 110406-94-5 |
Molecular Formula | C14H21N3O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N'-(1-methylazepan-4-yl)benzohydrazide |
InChI | InChI=1S/C14H21N3O/c1-17-10-5-8-13(9-11-17)15-16-14(18)12-6-3-2-4-7-12/h2-4,6-7,13,15H,5,8-11H2,1H3,(H,16,18) |
InChIKey | HJCSHXABAVJCGJ-UHFFFAOYSA-N |
SMILES | CN1CCCC(CC1)NNC(=O)C2=CC=CC=C2 |