For research use only. Not for therapeutic Use.
Benzoic acid, 3-(fluorosulfonyl)-4-methoxy-（Cat No.:L007534）, is a chemical compound with a molecular structure comprising a benzoic acid core substituted with a fluorosulfonyl group at the 3rd position and a methoxy group at the 4th position. This compound is significant in organic synthesis, serving as a valuable building block for the creation of various complex organic molecules. Its unique structure and reactivity enable its use in the development of specialized chemicals, pharmaceuticals, and agrochemicals.
| CAS Number | 199461-16-0 |
| Molecular Formula | C8H7FO5S |
| Purity | ≥95% |
| IUPAC Name | 3-fluorosulfonyl-4-methoxybenzoic acid |
| InChI | InChI=1S/C8H7FO5S/c1-14-6-3-2-5(8(10)11)4-7(6)15(9,12)13/h2-4H,1H3,(H,10,11) |
| InChIKey | TXPKNOFHNYQSLR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)O)S(=O)(=O)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
