For research use only. Not for therapeutic Use.
Benzoic acid, 4-[(4-aminophenyl)azo]- (CAT: L002781), commonly known as Sudan I, is a synthetic azo dye used as a coloring agent in various industries, including textiles, plastics, and food. However, its notoriety stems from safety concerns, particularly in the food industry, where it has been restricted or banned in many countries due to potential carcinogenicity.
CAS Number | 6925-48-0 |
Molecular Formula | C13H11N3O2 |
Purity | ≥95% |
Documentation | |
IUPAC Name | 4-[(4-aminophenyl)diazenyl]benzoic acid |
InChI | InChI=1S/C13H11N3O2/c14-10-3-7-12(8-4-10)16-15-11-5-1-9(2-6-11)13(17)18/h1-8H,14H2,(H,17,18) |
InChIKey | KJNBDJZDRNLJJG-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |