For research use only. Not for therapeutic Use.
Benzoic acid, 5-bromo-2,4-dimethyl-, methyl ester(Cat No.:M128793)is an aromatic ester used in organic synthesis and pharmaceutical research. This compound features a benzoic acid core with bromine at the 5-position, methyl groups at the 2- and 4-positions, and a methyl ester functional group. It serves as a versatile intermediate in the synthesis of bioactive molecules, including potential drug candidates and fine chemicals. The unique substitution pattern enhances its reactivity, making it valuable in developing complex chemical structures in medicinal chemistry and advanced materials science.
Catalog Number | M128793 |
CAS Number | 152849-72-4 |
Molecular Formula | C10H11BrO2 |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | methyl 5-bromo-2,4-dimethylbenzoate |
InChI | InChI=1S/C10H11BrO2/c1-6-4-7(2)9(11)5-8(6)10(12)13-3/h4-5H,1-3H3 |
InChIKey | DVWSCROTFQAIEU-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1C(=O)OC)Br)C |