For research use only. Not for therapeutic Use.
Benzoic acid, 5-iodo-2-methyl-, methyl ester（Cat No.:M010172）is a methylated ester of benzoic acid distinguished by an iodine and a methyl group on the aromatic ring. This compound is utilized extensively in organic synthesis, particularly in the production of various pharmaceuticals and fine chemicals. The iodine substituent enhances its reactivity in electrophilic substitution reactions, making it suitable for further functionalization. Its ester group increases solubility in organic solvents, facilitating its use in diverse synthetic pathways. This compound is crucial for developing complex molecules with potential applications in medicine and materials science.
| Catalog Number | M010172 |
| CAS Number | 103440-54-6 |
| Molecular Formula | C9H9IO2 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | methyl 5-iodo-2-methylbenzoate |
| InChI | InChI=1S/C9H9IO2/c1-6-3-4-7(10)5-8(6)9(11)12-2/h3-5H,1-2H3 |
| InChIKey | BXVIKPGEGLOGLU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)I)C(=O)OC |
