For research use only. Not for therapeutic Use.
Benzoic acid（Cat No.:A000592）is a simple aromatic carboxylic acid, naturally occurring in various plants and serving as an important precursor in the synthesis of many other organic substances. It appears as a colorless crystalline solid with a faint, pleasant odor. Commonly used as a food preservative under the E-number E210, benzoic acid inhibits the growth of mold, yeast, and some bacteria. It is also used in the manufacture of pharmaceuticals, dyes, plastics, and insect repellents. In cosmetics, it functions as a preservative due to its antimicrobial properties.
| Catalog Number | A000592 |
| CAS Number | 65-85-0 |
| Synonyms | FEMA 2131 |
| Molecular Formula | C7H6O2 |
| Purity | ≥95% |
| IUPAC Name | benzoic acid |
| InChI | InChI=1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9) |
| InChIKey | WPYMKLBDIGXBTP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)O |
