For research use only. Not for therapeutic Use.
Benzoic Acid-d5 Ethyl Ester(Cat No.:R058676) is a deuterated form of benzoic acid ethyl ester, where five hydrogen atoms are replaced with deuterium. This isotopic modification significantly enhances the compound’s stability and is particularly valuable in analytical chemistry for mass spectrometry and NMR studies. It serves as an excellent internal standard due to its stable isotopic labeling, facilitating accurate quantification and analysis of complex organic mixtures. Benzoic Acid-d5 Ethyl Ester is commonly used in the food and fragrance industries to understand the behavior of esters in various formulations, improving product quality and consistency.
CAS Number | 54354-03-9 |
Synonyms | Ethyl Benzenecarboxylate-d5; Ethyl Benzoate-d5; NSC 8884-d5 |
Molecular Formula | C9H10O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | ethyl 2,3,4,5,6-pentadeuteriobenzoate |
InChI | InChI=1S/C9H10O2/c1-2-11-9(10)8-6-4-3-5-7-8/h3-7H,2H2,1H3/i3D,4D,5D,6D,7D |
InChIKey | MTZQAGJQAFMTAQ-DKFMXDSJSA-N |
SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(=O)OCC)[2H])[2H] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |