For research use only. Not for therapeutic Use.
BENZOIC ACID, p-(9-ACRIDINYLAMINO)- (Cat.No:L003383) is a crucial compound in pharmaceutical research. Its structure incorporates an acridinylamino group, conferring unique pharmacological properties. This compound serves as a pivotal intermediate in the synthesis of specialized pharmaceutical agents, underscoring its significance in drug development processes.
Catalog Number | L003383 |
CAS Number | 64894-83-3 |
Molecular Formula | C20H14N2O2 |
Purity | ≥95% |
IUPAC Name | 4-(acridin-9-ylamino)benzoic acid |
InChI | InChI=1S/C20H14N2O2/c23-20(24)13-9-11-14(12-10-13)21-19-15-5-1-3-7-17(15)22-18-8-4-2-6-16(18)19/h1-12H,(H,21,22)(H,23,24) |
InChIKey | FNNMCOQMDNRQHG-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=N2)NC4=CC=C(C=C4)C(=O)O |