For research use only. Not for therapeutic Use.
Benzoin (Cat.No:R023434) is a white crystalline compound with a sweet balsamic scent. It is utilized in perfumery, as a flavoring agent, and in pharmaceuticals. Benzoin also serves as a precursor in the synthesis of various organic compounds. Additionally, it finds applications in traditional medicine for its aromatic and antiseptic properties.
| Catalog Number | R023434 |
| CAS Number | 119-53-9 |
| Synonyms | (RS)-Benzoin; (±)-2-Hydroxy-1,2-diphenylethanone; (±)-2-Hydroxy-2-phenylacetophenone; (±)-Benzoin; 1,2-Diphenyl-1-hydroxy-2-ethanone; 1,2-Diphenyl-2-hydroxyethanone; 1,2-Diphenyl-2-oxoethanol; 2-Hydroxy-1,2-diphenyl-1-ethanone; 2-Hydroxy-1,2-diphenyl |
| Molecular Formula | C14H12O2 |
| Purity | ≥95% |
| Target | Disease Research Fields |
| Storage | Store at +4C |
| IUPAC Name | 2-hydroxy-1,2-diphenylethanone |
| InChI | InChI=1S/C14H12O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13,15H |
| InChIKey | ISAOCJYIOMOJEB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)C2=CC=CC=C2)O |
