For research use only. Not for therapeutic Use.
Benzomalvin C(CAT: I011857) is a naturally occurring fungal metabolite belonging to the benzodiazepine alkaloid family. It is biosynthesized by various Aspergillus species and exhibits potential biological activities, including antimicrobial and anticancer properties. Benzomalvin C functions by interfering with key cellular pathways, although its exact molecular targets remain under investigation. Its unique benzodiazepine structure makes it a promising compound in the Natural Products and Oncology research fields, where it is explored for its cytotoxic effects on cancer cells and antimicrobial potential. Additionally, its complex structure offers valuable insights into natural product biosynthesis and drug discovery.
CAS Number | 157047-98-8 |
Synonyms | benzomalvin C |
Molecular Formula | C24H17N3O3 |
Purity | 95% |
Appearance | White to off-white solid |
Storage | -20°C |
Analysis method | HPLC |
IUPAC Name | 6'-methyl-3-phenylspiro[oxirane-2,7'-quinazolino[3,2-a][1,4]benzodiazepine]-5',13'-dione |
InChI | InChI=1S/C24H17N3O3/c1-26-21(28)17-12-6-8-14-19(17)27-22(29)16-11-5-7-13-18(16)25-23(27)24(26)20(30-24)15-9-3-2-4-10-15/h2-14,20H,1H3 |
InChIKey | TWDKBDSVUUKABK-UHFFFAOYSA-N |
SMILES | CN1C(=O)C2=CC=CC=C2N3C(=O)C4=CC=CC=C4N=C3C15C(O5)C6=CC=CC=C6 |