For research use only. Not for therapeutic Use.
4-Hydroxy-3-methylbenzophenone is a high-purity chemical compound commonly used in research and development, particularly in photochemical and pharmaceutical studies. This benzophenone derivative features a hydroxyl group at the 4-position and a methyl group at the 3-position on the aromatic ring. It serves as a key intermediate in the synthesis of various organic compounds and has applications in UV filtering, drug discovery, and material science. Its stability and reactivity make it a valuable tool for experimental protocols.
Catalog Number | L014063 |
CAS Number | 5326-42-1 |
Molecular Formula | C14H12O2 |
Purity | ≥95% |
IUPAC Name | (4-hydroxy-3-methylphenyl)-phenylmethanone |
InChI | InChI=1S/C14H12O2/c1-10-9-12(7-8-13(10)15)14(16)11-5-3-2-4-6-11/h2-9,15H,1H3 |
InChIKey | UDGHTNPEJPFNIP-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC(=C1)C(=O)C2=CC=CC=C2)O |