For research use only. Not for therapeutic Use.
Benzophenone(CAT: R013378) is a widely used organic compound with diverse applications in the fields of chemistry and industry. It is a pale yellow crystalline solid and is known for its unique properties, primarily as a photoinitiator in the production of various plastics, coatings, and adhesives. Benzophenone absorbs ultraviolet (UV) light and facilitates photochemical reactions, making it a key component in UV-curing processes.
| Catalog Number | R013378 |
| CAS Number | 119-61-9 |
| Synonyms | Diphenylmethanone; Adjutan 6016; BLS 531; Benzoylbenzene; Darocur BP; Diphenyl Ketone; Kayacure BP; Kayacure BP 100; Lowlite 24; NSC 8077; Phenyl Ketone; Runtecure 1020; Speedcure BP; α-Oxodiphenylmethane; α-Oxoditane; |
| Molecular Formula | C13H10O |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | Store at RT |
| IUPAC Name | diphenylmethanone |
| InChI | InChI=1S/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | RWCCWEUUXYIKHB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
