For research use only. Not for therapeutic Use.
Benzoquinoquinoxaline(Cat No.:I042921)is a heterocyclic compound featuring both quinoxaline and benzoquinone structures. It is of interest in organic chemistry and material science due to its unique electronic properties, which make it useful in the development of organic semiconductors and photoactive materials. Benzoquinoquinoxaline has potential applications in optoelectronic devices, such as organic light-emitting diodes (OLEDs), organic solar cells, and fluorescent sensors. Additionally, its redox-active nature makes it valuable in studies related to electron transfer processes and chemical reactivity. Research is ongoing to explore its full range of applications in electronics and sensing technologies.
CAS Number | 207671-99-6 |
Synonyms | N’-(19-methoxy-2,10,13-triazapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),2,4,6,8,10,12,15,17(22),18,20-undecaen-11-yl)propane-1,3-diamine |
Molecular Formula | C23H21N5O |
Purity | ≥95% |
IUPAC Name | N'-(19-methoxy-2,10,13-triazapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),2,4,6,8,10,12,15,17(22),18,20-undecaen-11-yl)propane-1,3-diamine |
InChI | InChI=1S/C23H21N5O/c1-29-15-8-9-16-14(13-15)7-10-19-20(16)28-21-17-5-2-3-6-18(17)27-23(22(21)26-19)25-12-4-11-24/h2-3,5-10,13H,4,11-12,24H2,1H3,(H,25,27) |
InChIKey | VLYNNEGUOHUAER-UHFFFAOYSA-N |
SMILES | COC1=CC2=C(C=C1)C3=C(C=C2)N=C4C(=N3)C5=CC=CC=C5N=C4NCCCN |