For research use only. Not for therapeutic Use.
Benzothiazole-2-acetonitrile(Cat No.:L016953)is a versatile heterocyclic compound used in organic synthesis and pharmaceutical research. The structure includes a benzothiazole ring attached to an acetonitrile group at the 2-position, offering unique reactivity and stability. This compound is particularly valuable as an intermediate in the synthesis of biologically active molecules, including potential drug candidates and agrochemicals. Its nitrile group allows for further chemical transformations, making it a key building block in the development of complex molecular frameworks for advanced medicinal chemistry and material science applications.
CAS Number | 56278-50-3 |
Molecular Formula | C9H6N2S |
Purity | ≥95% |
IUPAC Name | 2-(1,3-benzothiazol-2-yl)acetonitrile |
InChI | InChI=1S/C9H6N2S/c10-6-5-9-11-7-3-1-2-4-8(7)12-9/h1-4H,5H2 |
InChIKey | ZMZSYUSDGRJZNT-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)N=C(S2)CC#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |