For research use only. Not for therapeutic Use.
Benzothiazole (Cat No.:R013531) serves as a versatile chemical intermediate in organic synthesis, finding applications as a precursor for rubber accelerators and a component of cyanine dyes. While the specific action target and mode of action are not explicitly mentioned, Benzothiazole’s role as a foundational building block suggests its involvement in various chemical reactions. Its applications span multiple industries, including rubber manufacturing, where it contributes to accelerating vulcanization processes, and in dye production, where it imparts color properties. Its widespread utility as a chemical intermediate underscores its importance in facilitating the synthesis of diverse compounds across industries such as pharmaceuticals, agrochemicals, and materials science.
| Catalog Number | R013531 |
| CAS Number | 95-16-9 |
| Synonyms | 1-Thia-3-azaindene; Benzo[d]thiazole; Benzosulfonazole; NSC 8040; Vangard BT; |
| Molecular Formula | C7H5NS |
| Purity | ≥95% |
| Target | Bacterial |
| Storage | -20°C |
| IUPAC Name | 1,3-benzothiazole |
| InChI | InChI=1S/C7H5NS/c1-2-4-7-6(3-1)8-5-9-7/h1-5H |
| InChIKey | IOJUPLGTWVMSFF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=CS2 |
