Benzotriazol-1-yl-oxytripyrrolidinphosphonium hexafluorophosphate (Cat No.:R000033) is a coupling reagent used in peptide synthesis to facilitate the formation of peptide bonds between amino acids. It functions by activating the carboxyl group of one amino acid, making it more reactive towards nucleophilic attack by the amino group of another amino acid. PyBOP is preferred for its high efficiency and mild reaction conditions, leading to high yields and minimal side reactions. Its use has become widespread in both research and industrial settings for the synthesis of peptides with complex structures, including pharmaceuticals and peptide-based materials.
| Catalog Number | R000033 |
| CAS Number | 128625-52-5 |
| Synonyms | PYBOP; |
| Molecular Formula | C18H28F6N6OP2 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | benzotriazol-1-yloxy(tripyrrolidin-1-yl)phosphanium;hexafluorophosphate |
| InChI | InChI=1S/C18H28N6OP.F6P/c1-2-10-18-17(9-1)19-20-24(18)25-26(21-11-3-4-12-21,22-13-5-6-14-22)23-15-7-8-16-23;1-7(2,3,4,5)6/h1-2,9-10H,3-8,11-16H2;/q+1;-1 |
| InChIKey | VIAFLMPQBHAMLI-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)[P+](N2CCCC2)(N3CCCC3)ON4C5=CC=CC=C5N=N4.F[P-](F)(F)(F)(F)F |
