For research use only. Not for therapeutic Use.
Benzouracil（Cat No.:R022507）is a potent, synthetic uracil derivative commonly used in biochemical and pharmaceutical research. It acts as an inhibitor of thymidylate synthase (TS), a key enzyme in DNA synthesis, by mimicking uracil. This interference with DNA replication makes Benzouracil valuable in cancer research and potential anti-cancer therapies. Additionally, it plays a significant role in the study of pyrimidine metabolism and the regulation of nucleotide pools in rapidly dividing cells. Benzouracil is a critical tool in understanding mechanisms of drug resistance and cellular responses to chemotherapy.
| Catalog Number | R022507 |
| CAS Number | 86-96-4 |
| Synonyms | 1,2,3,4-Tetrahydro-2,4-dioxoquinazoline; 1,2,3,4-Tetrahydroquinazoline-2,4-dione; 2,4-Dihydroxyquinazoline; 2,4-Dioxotetrahydroquinazoline; 2,4-Quinazolinediol; Benzoyleneurea; NSC 2108; Quinazoline-2,4-dione; Quinazolinedione; y-Thymine; yT |
| Molecular Formula | C8H6N2O2 |
| Purity | ≥95% |
| Target | Bacterial |
| Storage | -20°C |
| IUPAC Name | 1H-quinazoline-2,4-dione |
| InChI | InChI=1S/C8H6N2O2/c11-7-5-3-1-2-4-6(5)9-8(12)10-7/h1-4H,(H2,9,10,11,12) |
| InChIKey | SDQJTWBNWQABLE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC(=O)N2 |
