For research use only. Not for therapeutic Use.
5-Methoxybenzoxazole is a heterocyclic compound characterized by a benzoxazole ring with a methoxy group at the 5-position. This compound is valued in organic synthesis and medicinal chemistry due to its potential biological activities, including antimicrobial and anti-inflammatory properties. The methoxy substituent enhances the compound’s solubility and reactivity, making it useful for further modifications. It is often employed as a building block in the development of pharmaceuticals and agrochemicals, contributing to the synthesis of various bioactive molecules.
| Catalog Number | M115530 |
| CAS Number | 132227-03-3 |
| Molecular Formula | C8H7NO2 |
| Purity | ≥95% |
| Storage | Desiccate at -20C |
| IUPAC Name | 5-methoxy-1,3-benzoxazole |
| InChI | InChI=1S/C8H7NO2/c1-10-6-2-3-8-7(4-6)9-5-11-8/h2-5H,1H3 |
| InChIKey | IQQKXTVYGHYXFX-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)OC=N2 |
