For research use only. Not for therapeutic Use.
Benzoylmetronidazole(Cat No.:R015493)is a chemical compound that combines the anti-protozoal and antibacterial properties of metronidazole with a benzoyl group. It is primarily studied for its potential in treating infections caused by anaerobic bacteria and protozoa. The compound acts by inhibiting DNA synthesis in target cells, leading to microbial cell death. Benzoylmetronidazole has been explored in dermatological applications, particularly for treating acne and rosacea, due to its anti-inflammatory and antimicrobial effects. Its pharmacokinetic properties and efficacy make it a valuable candidate in infection management and dermatology research.
CAS Number | 13182-89-3 |
Synonyms | Klion Suspension; Metronidazole Benzoate; 2-Methyl-5-nitro-1H-imidazole-1-ethanol 1-Benzoate |
Molecular Formula | C13H13N3O4 |
Purity | ≥95% |
Target | Bacterial |
Storage | Store at -20°C |
IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl benzoate |
InChI | InChI=1S/C13H13N3O4/c1-10-14-9-12(16(18)19)15(10)7-8-20-13(17)11-5-3-2-4-6-11/h2-6,9H,7-8H2,1H3 |
InChIKey | CUUCCLJJOWSASK-UHFFFAOYSA-N |
SMILES | CC1=NC=C(N1CCOC(=O)C2=CC=CC=C2)[N+](=O)[O-] |