For research use only. Not for therapeutic Use.
Benzoylnitromethane(Cat No.:L007075), is an organic compound characterized by a benzoyl group (-C6H5CO) attached to a nitromethane moiety (-CH2NO2). It is used as a versatile reagent in organic synthesis, particularly in the preparation of various organic compounds. Benzoylnitromethane participates in reactions such as Michael additions and condensation reactions, enabling the formation of complex molecules. Its unique reactivity and ability to introduce both nitro and carbonyl functionalities make it valuable in the creation of diverse chemical entities, including pharmaceuticals, agrochemicals, and specialty chemicals. Researchers utilize benzoyl nitromethane as a key building block in the development of novel organic molecules for scientific research and industrial applications.
CAS Number | 614-21-1 |
Molecular Formula | C8H7NO3 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 2-nitro-1-phenylethanone |
InChI | InChI=1S/C8H7NO3/c10-8(6-9(11)12)7-4-2-1-3-5-7/h1-5H,6H2 |
InChIKey | JTWHVBNYYWFXSI-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C(=O)C[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |