For research use only. Not for therapeutic Use.
Benzydamine HCl is a nonsteroidal anti-inflammatory drug (NSAID) commonly used for its analgesic, anti-inflammatory, and local anesthetic properties. It is primarily employed in the treatment of pain and inflammation associated with conditions like sore throat, mouth ulcers, and gingivitis. Benzydamine HCl functions by inhibiting the production of prostaglandins, thereby reducing pain and inflammation. It is also used as a topical agent in various formulations for oral and throat conditions, providing effective relief in short-term treatments.
| Catalog Number | A000629 |
| CAS Number | 132-69-4 |
| Synonyms | AF864 |
| Molecular Formula | C19H23N3O.HCl |
| Purity | ≥95% |
| Target | Anti-infection |
| Storage | 3 years -20 ℃ |
| IUPAC Name | 3-(1-benzylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine;hydrochloride |
| InChI | 1S/C19H23N3O.ClH/c1-21(2)13-8-14-23-19-17-11-6-7-12-18(17)22(20-19)15-16-9-4-3-5-10-16;/h3-7,9-12H,8,13-15H2,1-2H3;1H |
| InChIKey | HNNIWKQLJSNAEQ-UHFFFAOYSA-N |
| SMILES | CN(C)CCCOC1=NN(C2=CC=CC=C21)CC3=CC=CC=C3.Cl |
