For research use only. Not for therapeutic Use.
Benzyl β-D-glucopyranosiduronic acid (Cat No.: R056661) is a chemical compound derived from glucose and uronic acid, with a benzyl group attached to the glucose moiety. This compound is notable for its role in carbohydrate chemistry and as a glycoside. Its synthesis involves linking a benzyl group to the glucopyranosyl unit, forming a stable glycosidic linkage. Benzyl β-D-glucopyranosiduronic acid can be used in organic synthesis and biochemical research related to glycosides and carbohydrate derivatives.
Catalog Number | R056661 |
CAS Number | 5285-02-9 |
Synonyms | Benzyl Alcohol Glucuronide; Benzyl β-D-Glucopyranosiduronic Acid |
Molecular Formula | C13H16O7 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-phenylmethoxyoxane-2-carboxylic acid |
InChI | InChI=1S/C13H16O7/c14-8-9(15)11(12(17)18)20-13(10(8)16)19-6-7-4-2-1-3-5-7/h1-5,8-11,13-16H,6H2,(H,17,18)/t8-,9-,10+,11-,13+/m0/s1 |
InChIKey | UDTQUOJQGJBORK-XPORZQOISA-N |
SMILES | C1=CC=C(C=C1)COC2C(C(C(C(O2)C(=O)O)O)O)O |