For research use only. Not for therapeutic Use.
Benzyl 1H-pyrrole-1-carbodithioate(CAT: L000338) is a compound of relevance in organic chemistry and material science. This chemical, characterized by its carbodithioate group attached to a pyrrole ring, serves as a versatile building block for the synthesis of various organic molecules. In the field of organic chemistry, it is often used in the preparation of sulfur-containing compounds and as a key intermediate for diverse chemical transformations.
CAS Number | 60795-38-2 |
Molecular Formula | C12H11NS2 |
Purity | ≥95% |
IUPAC Name | benzyl pyrrole-1-carbodithioate |
InChI | InChI=1S/C12H11NS2/c14-12(13-8-4-5-9-13)15-10-11-6-2-1-3-7-11/h1-9H,10H2 |
InChIKey | AGCPVOYGTAIJAP-UHFFFAOYSA-N |